| ID: | N2031 | |
|---|---|---|
| Name: | propanone, 1-hexyl-3-methylimidazolium trifluoroacetate | |
| Description: | propanone [HMIm]+[AcF3]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C10H19N2.C3H6O.C2HF3O2/c1-3-4-5-6-7-12-9-8-11(2)10-12;1-3(2)4;3-2(4,5)1(6)7/h8-10H,3-7H2,1-2H3;1-2H3;(H,6,7)/q+1;;/p-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.257 |
experimental value |
| 2.472739956090001 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.53819501276579 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |