| ID: | N2101 | |
|---|---|---|
| Name: | benzene, 1-ethyl-3-methylimidazolium methanesulfonate | |
| Description: | benzene [EMIm]+[MeSO3]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C6H11N2.C6H6.CH4O3S/c1-3-8-5-4-7(2)6-8;1-2-4-6-5-3-1;1-5(2,3)4/h4-6H,3H2,1-2H3;1-6H;1H3,(H,2,3,4)/q+1;;/p-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.296642190383841 |
experimental value |
| 2.372366859059635 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.419732974422008 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |