| ID: | N2106 | |
|---|---|---|
| Name: | tetrachloromethane, 1-ethyl-3-methylimidazolium dicyanamide | |
| Description: | tetrachloromethane [EMIm]+[N(CN)2]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C6H11N2.C2N3.CCl4/c1-3-8-5-4-7(2)6-8;3-1-5-2-4;2-1(3,4)5/h4-6H,3H2,1-2H3;;/q+1;-1; |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.3 |
experimental value |
| 2.139389400780326 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.412968453828207 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |