| ID: | N3851 | |
|---|---|---|
| Name: | trichloromethane, 1-ethyl-3-methylimidazolium nitrate | |
| Description: | trichloromethane [MEIm]+[NO3]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C6H11N2.CHCl3.NO3/c1-3-8-5-4-7(2)6-8;2*2-1(3)4/h4-6H,3H2,1-2H3;1H;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 2.987 |
experimental value |
| 2.126922867678679 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.815330000000001 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |