| ID: | N4011 | |
|---|---|---|
| Name: | ethyl acetate, 1-hexyl-3-methylimidazolium tetracyanoborate | |
| Description: | ethyl acetate [MHIm]+[B(CN)4]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C10H19N2.C4BN4.C4H8O2/c1-3-4-5-6-7-12-9-8-11(2)10-12;6-1-5(2-7,3-8)4-9;1-3-6-4(2)5/h8-10H,3-7H2,1-2H3;;3H2,1-2H3/q+1;-1; |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.046 |
experimental value |
| 2.734475031833701 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.076048968317436 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |