| ID: | N5626 | |
|---|---|---|
| Name: | 1-hexanal, 1-hexyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide | |
| Description: | 1-hexanal [MHIm]+[Tf2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C10H19N2.C6H12O.C2F6NO4S2/c1-3-4-5-6-7-12-9-8-11(2)10-12;1-2-3-4-5-6-7;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h8-10H,3-7H2,1-2H3;6H,2-5H2,1H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.716 |
experimental value |
| 3.53990932296645 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.739928414598828 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |