| ID: | N5686 | |
|---|---|---|
| Name: | 1,3-dimethylbenzene, n-butyl-n-methylpyrrolidinium tetracyanoborate | |
| Description: | 1,3-dimethylbenzene [BMPyrr]+[B(CN)4]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C9H20N.C8H10.C4BN4/c1-3-4-7-10(2)8-5-6-9-10;1-7-4-3-5-8(2)6-7;6-1-5(2-7,3-8)4-9/h3-9H2,1-2H3;3-6H,1-2H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.741341748799165 |
experimental value |
| 3.744689195715824 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.722259659760163 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |