| ID: | N5781 | |
|---|---|---|
| Name: | 1-butanol, n-butyl-n-methylpyrrolidinium triflate | |
| Description: | 1-butanol [BMPyrr]+[Trif]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C9H20N.C4H10O.CHF3O3S/c1-3-4-7-10(2)8-5-6-9-10;1-2-3-4-5;2-1(3,4)8(5,6)7/h3-9H2,1-2H3;5H,2-4H2,1H3;(H,5,6,7)/q+1;;/p-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.800118153951993 |
experimental value |
| 3.376067866319514 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.8345363359037 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |