| ID: | N6251 | |
|---|---|---|
| Name: | ethyl phenyl ether, n-propyl-n-methylpiperidinium bis(trifluoromethylsulfonyl)imide | |
| Description: | ethyl phenyl ether [PMPip]+[(Tf)2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C9H20N.C8H10O.C2F6NO4S2/c1-3-7-10(2)8-5-4-6-9-10;1-2-9-8-6-4-3-5-7-8;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-9H2,1-2H3;3-7H,2H2,1H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 4.433453718998387 |
experimental value |
| 4.614847763837629 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 4.291184432907063 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |