| ID: | N6461 | |
|---|---|---|
| Name: | acetophenone, 1-(2-methoxyethyl)-1-methylpiperidinium tris(pentafluoroethyl)trifluorophosphate | |
| Description: | acetophenone [MeoeMPip]+[FAP]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C9H20NO.C8H8O.C6F18P/c1-3-11-9-10(2)7-5-4-6-8-10;1-7(9)8-5-3-2-4-6-8;7-1(8,9)4(16,17)25(22,23,24,5(18,19)2(10,11)12)6(20,21)3(13,14)15/h3-9H2,1-2H3;2-6H,1H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 5.423755437738565 |
experimental value |
| 5.351347115796178 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 5.416206444343632 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |